C24H32N6O4 — CID 130419243
(2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[8-(furan-3-ylmethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol (PubChem CID 130419243) has the molecular formula C24H32N6O4 and a molecular weight of 468.56 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[8-(furan-3-ylmethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[8-(furan-3-ylmethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 130419243 |
| Molecular Formula | C24H32N6O4 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[8-(furan-3-ylmethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1O[C@H](CN2CCCC23CCN(Cc2ccoc2)CC3)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H32N6O4/c25-21-17-2-8-30(22(17)27-15-26-21)23-20(32)19(31)18(34-23)13-29-7-1-4-24(29)5-9-28(10-6-24)12-16-3-11-33-14-16/h2-3,8,11,14-15,18-20,23,31-32H,1,4-7,9-10,12-13H2,(H2,25,26,27)/t18-,19-,20-,23-/m1/s1 |
| InChIKey | VUYKLRNOSGVFOS-GLHSZLCASA-N |
| XLogP | 1.36 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |