C27H33F3N6O3 — CID 130418984
(2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[3,3-difluoro-8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol (PubChem CID 130418984) has the molecular formula C27H33F3N6O3 and a molecular weight of 546.59 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[3,3-difluoro-8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[3,3-difluoro-8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 130418984 |
| Molecular Formula | C27H33F3N6O3 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[3,3-difluoro-8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1O[C@H](CN2CC(F)(F)CC23CCN(CCc2ccc(F)cc2)CC3)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H33F3N6O3/c28-18-3-1-17(2-4-18)5-9-34-11-7-26(8-12-34)14-27(29,30)15-35(26)13-20-21(37)22(38)25(39-20)36-10-6-19-23(31)32-16-33-24(19)36/h1-4,6,10,16,20-22,25,37-38H,5,7-9,11-15H2,(H2,31,32,33)/t20-,21-,22-,25-/m1/s1 |
| InChIKey | HFLLFIYRCMQZQX-NMOFPLQQSA-N |
| XLogP | 2.19 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |