C28H42F2N6O5 — CID 155122235
[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[(3,3-difluoro-8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]-4-(1-hydroxy-2-methylpropoxy)oxolan-3-yl] 2-methylpropanoate (PubChem CID 155122235) has the molecular formula C28H42F2N6O5 and a molecular weight of 580.68 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[(3,3-difluoro-8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]-4-(1-hydroxy-2-methylpropoxy)oxolan-3-yl] 2-methylpropanoate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[(3,3-difluoro-8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]-4-(1-hydroxy-2-methylpropoxy)oxolan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 155122235 |
| Molecular Formula | C28H42F2N6O5 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[(3,3-difluoro-8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]-4-(1-hydroxy-2-methylpropoxy)oxolan-3-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1[C@@H](OC(O)C(C)C)[C@H](n2ccc3c(N)ncnc32)O[C@@H]1CN1CC(F)(F)CC12CCN(C)CC2 |
| InChI | InChI=1S/C28H42F2N6O5/c1-16(2)25(37)40-20-19(12-35-14-28(29,30)13-27(35)7-10-34(5)11-8-27)39-24(21(20)41-26(38)17(3)4)36-9-6-18-22(31)32-15-33-23(18)36/h6,9,15-17,19-21,24,26,38H,7-8,10-14H2,1-5H3,(H2,31,32,33)/t19-,20-,21-,24-,26?/m1/s1 |
| InChIKey | RFPNKZBUOPWBRE-RWLSYODJSA-N |
| XLogP | 2.64 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|