C22H33F2N5O4 — CID 155122379
[1-[[(2S,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-(2-methoxypropan-2-yloxy)-3-methyloxolan-2-yl]methyl]-5,5-difluoropiperidin-2-yl]methanol (PubChem CID 155122379) has the molecular formula C22H33F2N5O4 and a molecular weight of 469.53 g/mol. Its IUPAC name is [1-[[(2S,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-(2-methoxypropan-2-yloxy)-3-methyloxolan-2-yl]methyl]-5,5-difluoropiperidin-2-yl]methanol.
| Compound Name | [1-[[(2S,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-(2-methoxypropan-2-yloxy)-3-methyloxolan-2-yl]methyl]-5,5-difluoropiperidin-2-yl]methanol |
|---|---|
| PubChem CID | 155122379 |
| Molecular Formula | C22H33F2N5O4 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | [1-[[(2S,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-(2-methoxypropan-2-yloxy)-3-methyloxolan-2-yl]methyl]-5,5-difluoropiperidin-2-yl]methanol |
| SMILES | COC(C)(C)O[C@@H]1[C@H](C)[C@@H](CN2CC(F)(F)CCC2CO)O[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C22H33F2N5O4/c1-13-16(9-28-11-22(23,24)7-5-14(28)10-30)32-20(17(13)33-21(2,3)31-4)29-8-6-15-18(25)26-12-27-19(15)29/h6,8,12-14,16-17,20,30H,5,7,9-11H2,1-4H3,(H2,25,26,27)/t13-,14?,16-,17-,20-/m1/s1 |
| InChIKey | GGXAQNOXIQKAPC-NWHUNKFXSA-N |
| XLogP | 2.41 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|