C30H41F3N6O3 — CID 145365080
7-[(2R,5S)-5-[[3,3-difluoro-8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine;propane-2,2-diol (PubChem CID 145365080) has the molecular formula C30H41F3N6O3 and a molecular weight of 590.69 g/mol. Its IUPAC name is 7-[(2R,5S)-5-[[3,3-difluoro-8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine;propane-2,2-diol.
| Compound Name | 7-[(2R,5S)-5-[[3,3-difluoro-8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine;propane-2,2-diol |
|---|---|
| PubChem CID | 145365080 |
| Molecular Formula | C30H41F3N6O3 |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | 7-[(2R,5S)-5-[[3,3-difluoro-8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine;propane-2,2-diol |
| SMILES | CC(C)(O)O.Nc1ncnn2c([C@H]3CC[C@@H](CN4CC(F)(F)CC45CCN(CCc4ccc(F)cc4)CC5)O3)ccc12 |
| InChI | InChI=1S/C27H33F3N6O.C3H8O2/c28-20-3-1-19(2-4-20)9-12-34-13-10-26(11-14-34)16-27(29,30)17-35(26)15-21-5-8-24(37-21)22-6-7-23-25(31)32-18-33-36(22)23;1-3(2,4)5/h1-4,6-7,18,21,24H,5,8-17H2,(H2,31,32,33);4-5H,1-2H3/t21-,24+;/m0./s1 |
| InChIKey | ZRFBUNSMOBCEBU-NXCGSPNESA-N |
| XLogP | 3.80 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|