C21H36N6O4 — CID 145365083
7-[(2R,5S)-5-[[(3R)-3-[(dimethylamino)methyl]morpholin-4-yl]methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine;propane-2,2-diol (PubChem CID 145365083) has the molecular formula C21H36N6O4 and a molecular weight of 436.56 g/mol. Its IUPAC name is 7-[(2R,5S)-5-[[(3R)-3-[(dimethylamino)methyl]morpholin-4-yl]methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine;propane-2,2-diol.
| Compound Name | 7-[(2R,5S)-5-[[(3R)-3-[(dimethylamino)methyl]morpholin-4-yl]methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine;propane-2,2-diol |
|---|---|
| PubChem CID | 145365083 |
| Molecular Formula | C21H36N6O4 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 7-[(2R,5S)-5-[[(3R)-3-[(dimethylamino)methyl]morpholin-4-yl]methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine;propane-2,2-diol |
| SMILES | CC(C)(O)O.CN(C)C[C@@H]1COCCN1C[C@@H]1CC[C@H](c2ccc3c(N)ncnn23)O1 |
| InChI | InChI=1S/C18H28N6O2.C3H8O2/c1-22(2)9-13-11-25-8-7-23(13)10-14-3-6-17(26-14)15-4-5-16-18(19)20-12-21-24(15)16;1-3(2,4)5/h4-5,12-14,17H,3,6-11H2,1-2H3,(H2,19,20,21);4-5H,1-2H3/t13-,14+,17-;/m1./s1 |
| InChIKey | XGQMUIFBWIBKIX-SLINCCQESA-N |
| XLogP | 0.50 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|