C23H34F2N6O3 — CID 145365002
tert-butyl N-[2-[(2R)-1-[[(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl]-4,4-difluoropiperidin-2-yl]ethyl]carbamate (PubChem CID 145365002) has the molecular formula C23H34F2N6O3 and a molecular weight of 480.56 g/mol. Its IUPAC name is tert-butyl N-[2-[(2R)-1-[[(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl]-4,4-difluoropiperidin-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2R)-1-[[(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl]-4,4-difluoropiperidin-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 145365002 |
| Molecular Formula | C23H34F2N6O3 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | tert-butyl N-[2-[(2R)-1-[[(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl]-4,4-difluoropiperidin-2-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC[C@@H]1CC(F)(F)CCN1CC1CC[C@H](c2ccc3c(N)ncnn23)O1 |
| InChI | InChI=1S/C23H34F2N6O3/c1-22(2,3)34-21(32)27-10-8-15-12-23(24,25)9-11-30(15)13-16-4-7-19(33-16)17-5-6-18-20(26)28-14-29-31(17)18/h5-6,14-16,19H,4,7-13H2,1-3H3,(H,27,32)(H2,26,28,29)/t15-,16?,19-/m1/s1 |
| InChIKey | JDQRCEFGPNIMAT-XBOMOHCESA-N |
| XLogP | 3.55 |
| TPSA | 107.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |