C19H28F2N6O — CID 156542769
7-[(2R,5S)-5-[[(2S)-2-[(dimethylamino)methyl]-4,4-difluoropiperidin-1-yl]methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 156542769) has the molecular formula C19H28F2N6O and a molecular weight of 394.47 g/mol. Its IUPAC name is 7-[(2R,5S)-5-[[(2S)-2-[(dimethylamino)methyl]-4,4-difluoropiperidin-1-yl]methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(2R,5S)-5-[[(2S)-2-[(dimethylamino)methyl]-4,4-difluoropiperidin-1-yl]methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 156542769 |
| Molecular Formula | C19H28F2N6O |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 7-[(2R,5S)-5-[[(2S)-2-[(dimethylamino)methyl]-4,4-difluoropiperidin-1-yl]methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CN(C)C[C@@H]1CC(F)(F)CCN1C[C@@H]1CC[C@H](c2ccc3c(N)ncnn23)O1 |
| InChI | InChI=1S/C19H28F2N6O/c1-25(2)10-13-9-19(20,21)7-8-26(13)11-14-3-6-17(28-14)15-4-5-16-18(22)23-12-24-27(15)16/h4-5,12-14,17H,3,6-11H2,1-2H3,(H2,22,23,24)/t13-,14-,17+/m0/s1 |
| InChIKey | RNHQKVPBFQIMOV-GRDNDAEWSA-N |
| XLogP | 2.19 |
| TPSA | 71.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |