C21H32N6O — CID 156542917
7-[(2R,5S)-5-[(8-ethyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 156542917) has the molecular formula C21H32N6O and a molecular weight of 384.53 g/mol. Its IUPAC name is 7-[(2R,5S)-5-[(8-ethyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(2R,5S)-5-[(8-ethyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 156542917 |
| Molecular Formula | C21H32N6O |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 7-[(2R,5S)-5-[(8-ethyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCN1CCC2(CCCN2C[C@@H]2CC[C@H](c3ccc4c(N)ncnn34)O2)CC1 |
| InChI | InChI=1S/C21H32N6O/c1-2-25-12-9-21(10-13-25)8-3-11-26(21)14-16-4-7-19(28-16)17-5-6-18-20(22)23-15-24-27(17)18/h5-6,15-16,19H,2-4,7-14H2,1H3,(H2,22,23,24)/t16-,19+/m0/s1 |
| InChIKey | RJRRQDKMJMSZJI-QFBILLFUSA-N |
| XLogP | 2.48 |
| TPSA | 71.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |