C24H29N5O4S — CID 170601299
N-[[(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl]naphthalene-2-sulfinamide;propane-2,2-diol (PubChem CID 170601299) has the molecular formula C24H29N5O4S and a molecular weight of 483.59 g/mol. Its IUPAC name is N-[[(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl]naphthalene-2-sulfinamide;propane-2,2-diol.
| Compound Name | N-[[(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl]naphthalene-2-sulfinamide;propane-2,2-diol |
|---|---|
| PubChem CID | 170601299 |
| Molecular Formula | C24H29N5O4S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | N-[[(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl]naphthalene-2-sulfinamide;propane-2,2-diol |
| SMILES | CC(C)(O)O.Nc1ncnn2c([C@H]3CCC(CNS(=O)c4ccc5ccccc5c4)O3)ccc12 |
| InChI | InChI=1S/C21H21N5O2S.C3H8O2/c22-21-19-9-8-18(26(19)24-13-23-21)20-10-6-16(28-20)12-25-29(27)17-7-5-14-3-1-2-4-15(14)11-17;1-3(2,4)5/h1-5,7-9,11,13,16,20,25H,6,10,12H2,(H2,22,23,24);4-5H,1-2H3/t16?,20-,29?;/m1./s1 |
| InChIKey | VLEAKJBURJPUIO-PIKHGTGKSA-N |
| XLogP | 2.70 |
| TPSA | 135.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|