C17H18ClFN2O3S — CID 130420489
5-chloro-6-fluoro-1-methyl-N-[(2E,4E)-5-methylsulfonylhexa-2,4-dien-2-yl]indole-2-carboxamide (PubChem CID 130420489) has the molecular formula C17H18ClFN2O3S and a molecular weight of 384.86 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1-methyl-N-[(2E,4E)-5-methylsulfonylhexa-2,4-dien-2-yl]indole-2-carboxamide.
| Compound Name | 5-chloro-6-fluoro-1-methyl-N-[(2E,4E)-5-methylsulfonylhexa-2,4-dien-2-yl]indole-2-carboxamide |
|---|---|
| PubChem CID | 130420489 |
| Molecular Formula | C17H18ClFN2O3S |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 5-chloro-6-fluoro-1-methyl-N-[(2E,4E)-5-methylsulfonylhexa-2,4-dien-2-yl]indole-2-carboxamide |
| SMILES | C/C(=C\C=C(/C)S(C)(=O)=O)NC(=O)c1cc2cc(Cl)c(F)cc2n1C |
| InChI | InChI=1S/C17H18ClFN2O3S/c1-10(5-6-11(2)25(4,23)24)20-17(22)16-8-12-7-13(18)14(19)9-15(12)21(16)3/h5-9H,1-4H3,(H,20,22)/b10-5+,11-6+ |
| InChIKey | XYPJZZMRHWNZNN-YOYBCKCWSA-N |
| XLogP | 3.55 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|