C8H15BrN2 — CID 130421729
1,1-dimethyl-2-propylimidazol-1-ium bromide (PubChem CID 130421729) has the molecular formula C8H15BrN2 and a molecular weight of 219.13 g/mol. Its IUPAC name is 1,1-dimethyl-2-propylimidazol-1-ium bromide.
| Compound Name | 1,1-dimethyl-2-propylimidazol-1-ium bromide |
|---|---|
| PubChem CID | 130421729 |
| Molecular Formula | C8H15BrN2 |
| Molecular Weight | 219.13 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 1,1-dimethyl-2-propylimidazol-1-ium bromide |
| SMILES | CCCC1=NC=C[N+]1(C)C.[Br-] |
| InChI | InChI=1S/C8H15N2.BrH/c1-4-5-8-9-6-7-10(8,2)3;/h6-7H,4-5H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | RYSCHDNBIXGYEW-UHFFFAOYSA-M |
| XLogP | -1.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.13 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|