C15H21N3O3S — CID 130422190
ethyl 3-cyclopentyl-2-[(3-methylsulfanyl-1,2,4-triazin-6-yl)methyl]-3-oxopropanoate (PubChem CID 130422190) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is ethyl 3-cyclopentyl-2-[(3-methylsulfanyl-1,2,4-triazin-6-yl)methyl]-3-oxopropanoate.
| Compound Name | ethyl 3-cyclopentyl-2-[(3-methylsulfanyl-1,2,4-triazin-6-yl)methyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 130422190 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | ethyl 3-cyclopentyl-2-[(3-methylsulfanyl-1,2,4-triazin-6-yl)methyl]-3-oxopropanoate |
| SMILES | CCOC(=O)C(Cc1cnc(SC)nn1)C(=O)C1CCCC1 |
| InChI | InChI=1S/C15H21N3O3S/c1-3-21-14(20)12(13(19)10-6-4-5-7-10)8-11-9-16-15(22-2)18-17-11/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | DXZIDNLTYVVDFW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|