C19H23F3O3 — CID 164553053
ethyl 3-cyclohexyl-3-oxo-2-[[3-(trifluoromethyl)phenyl]methyl]propanoate (PubChem CID 164553053) has the molecular formula C19H23F3O3 and a molecular weight of 356.38 g/mol. Its IUPAC name is ethyl 3-cyclohexyl-3-oxo-2-[[3-(trifluoromethyl)phenyl]methyl]propanoate.
| Compound Name | ethyl 3-cyclohexyl-3-oxo-2-[[3-(trifluoromethyl)phenyl]methyl]propanoate |
|---|---|
| PubChem CID | 164553053 |
| Molecular Formula | C19H23F3O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | ethyl 3-cyclohexyl-3-oxo-2-[[3-(trifluoromethyl)phenyl]methyl]propanoate |
| SMILES | CCOC(=O)C(Cc1cccc(C(F)(F)F)c1)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C19H23F3O3/c1-2-25-18(24)16(17(23)14-8-4-3-5-9-14)12-13-7-6-10-15(11-13)19(20,21)22/h6-7,10-11,14,16H,2-5,8-9,12H2,1H3 |
| InChIKey | KUGVPBBYMVUANF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|