C15H17Cl2NO3 — CID 87386275
ethyl 3-cyclobutyl-2-[(5,6-dichloro-3-pyridinyl)methyl]-3-oxopropanoate (PubChem CID 87386275) has the molecular formula C15H17Cl2NO3 and a molecular weight of 330.21 g/mol. Its IUPAC name is ethyl 3-cyclobutyl-2-[(5,6-dichloro-3-pyridinyl)methyl]-3-oxopropanoate.
| Compound Name | ethyl 3-cyclobutyl-2-[(5,6-dichloro-3-pyridinyl)methyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 87386275 |
| Molecular Formula | C15H17Cl2NO3 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | ethyl 3-cyclobutyl-2-[(5,6-dichloro-3-pyridinyl)methyl]-3-oxopropanoate |
| SMILES | CCOC(=O)C(Cc1cnc(Cl)c(Cl)c1)C(=O)C1CCC1 |
| InChI | InChI=1S/C15H17Cl2NO3/c1-2-21-15(20)11(13(19)10-4-3-5-10)6-9-7-12(16)14(17)18-8-9/h7-8,10-11H,2-6H2,1H3 |
| InChIKey | UFSKRPSYFFVNON-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|