C13H17ClF3NO3 — CID 68613329
ethyl (2S)-2-amino-3-[[3-(trifluoromethyl)phenyl]methoxy]propanoate;hydrochloride (PubChem CID 68613329) has the molecular formula C13H17ClF3NO3 and a molecular weight of 327.73 g/mol. Its IUPAC name is ethyl (2S)-2-amino-3-[[3-(trifluoromethyl)phenyl]methoxy]propanoate;hydrochloride.
| Compound Name | ethyl (2S)-2-amino-3-[[3-(trifluoromethyl)phenyl]methoxy]propanoate;hydrochloride |
|---|---|
| PubChem CID | 68613329 |
| Molecular Formula | C13H17ClF3NO3 |
| Molecular Weight | 327.73 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | ethyl (2S)-2-amino-3-[[3-(trifluoromethyl)phenyl]methoxy]propanoate;hydrochloride |
| SMILES | CCOC(=O)[C@@H](N)COCc1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C13H16F3NO3.ClH/c1-2-20-12(18)11(17)8-19-7-9-4-3-5-10(6-9)13(14,15)16;/h3-6,11H,2,7-8,17H2,1H3;1H/t11-;/m0./s1 |
| InChIKey | CGQMZGDRJZCDSK-MERQFXBCSA-N |
| XLogP | 2.53 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.73 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |