C15H13F6NO3 — CID 123777006
ethyl 4,4,4-trifluoro-3-oxo-2-[2-[3-(trifluoromethyl)phenyl]ethanimidoyl]butanoate (PubChem CID 123777006) has the molecular formula C15H13F6NO3 and a molecular weight of 369.26 g/mol. Its IUPAC name is ethyl 4,4,4-trifluoro-3-oxo-2-[2-[3-(trifluoromethyl)phenyl]ethanimidoyl]butanoate.
| Compound Name | ethyl 4,4,4-trifluoro-3-oxo-2-[2-[3-(trifluoromethyl)phenyl]ethanimidoyl]butanoate |
|---|---|
| PubChem CID | 123777006 |
| Molecular Formula | C15H13F6NO3 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | ethyl 4,4,4-trifluoro-3-oxo-2-[2-[3-(trifluoromethyl)phenyl]ethanimidoyl]butanoate |
| SMILES | [H]/N=C(/Cc1cccc(C(F)(F)F)c1)C(C(=O)OCC)C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H13F6NO3/c1-2-25-13(24)11(12(23)15(19,20)21)10(22)7-8-4-3-5-9(6-8)14(16,17)18/h3-6,11,22H,2,7H2,1H3/b22-10- |
| InChIKey | VGQWGNDUYWYAAD-YVNNLAQVSA-N |
| XLogP | 3.58 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|