C17H16F3NO4 — CID 23276632
[3-(trifluoromethyl)phenyl]methyl 2-amino-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 23276632) has the molecular formula C17H16F3NO4 and a molecular weight of 355.31 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 2-amino-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 2-amino-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 23276632 |
| Molecular Formula | C17H16F3NO4 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 2-amino-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | NC(Cc1ccc(O)c(O)c1)C(=O)OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3NO4/c18-17(19,20)12-3-1-2-11(6-12)9-25-16(24)13(21)7-10-4-5-14(22)15(23)8-10/h1-6,8,13,22-23H,7,9,21H2 |
| InChIKey | HXFWGCIPSBTKPE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|