C19H18ClN3O — CID 130423718
[(2R)-2-(4-chlorophenyl)pyrrolidin-1-yl]-(3-methyl-2H-indazol-5-yl)methanone (PubChem CID 130423718) has the molecular formula C19H18ClN3O and a molecular weight of 339.83 g/mol. Its IUPAC name is [(2R)-2-(4-chlorophenyl)pyrrolidin-1-yl]-(3-methyl-2H-indazol-5-yl)methanone.
| Compound Name | [(2R)-2-(4-chlorophenyl)pyrrolidin-1-yl]-(3-methyl-2H-indazol-5-yl)methanone |
|---|---|
| PubChem CID | 130423718 |
| Molecular Formula | C19H18ClN3O |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | [(2R)-2-(4-chlorophenyl)pyrrolidin-1-yl]-(3-methyl-2H-indazol-5-yl)methanone |
| SMILES | Cc1[nH]nc2ccc(C(=O)N3CCC[C@@H]3c3ccc(Cl)cc3)cc12 |
| InChI | InChI=1S/C19H18ClN3O/c1-12-16-11-14(6-9-17(16)22-21-12)19(24)23-10-2-3-18(23)13-4-7-15(20)8-5-13/h4-9,11,18H,2-3,10H2,1H3,(H,21,22)/t18-/m1/s1 |
| InChIKey | QJIOPOJQZXHHEW-GOSISDBHSA-N |
| XLogP | 4.50 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |