C22H22ClN3O — CID 163859685
[(2S)-2-(4-chlorophenyl)pyrrolidin-1-yl]-[3-(2-methylprop-2-enyl)-2H-indazol-5-yl]methanone (PubChem CID 163859685) has the molecular formula C22H22ClN3O and a molecular weight of 379.89 g/mol. Its IUPAC name is [(2S)-2-(4-chlorophenyl)pyrrolidin-1-yl]-[3-(2-methylprop-2-enyl)-2H-indazol-5-yl]methanone.
| Compound Name | [(2S)-2-(4-chlorophenyl)pyrrolidin-1-yl]-[3-(2-methylprop-2-enyl)-2H-indazol-5-yl]methanone |
|---|---|
| PubChem CID | 163859685 |
| Molecular Formula | C22H22ClN3O |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [(2S)-2-(4-chlorophenyl)pyrrolidin-1-yl]-[3-(2-methylprop-2-enyl)-2H-indazol-5-yl]methanone |
| SMILES | C=C(C)Cc1[nH]nc2ccc(C(=O)N3CCC[C@H]3c3ccc(Cl)cc3)cc12 |
| InChI | InChI=1S/C22H22ClN3O/c1-14(2)12-20-18-13-16(7-10-19(18)24-25-20)22(27)26-11-3-4-21(26)15-5-8-17(23)9-6-15/h5-10,13,21H,1,3-4,11-12H2,2H3,(H,24,25)/t21-/m0/s1 |
| InChIKey | PBJPJEXTPIEODW-NRFANRHFSA-N |
| XLogP | 5.31 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|