C19H21ClN2O — CID 42953210
[2-(4-chlorophenyl)pyrrolidin-1-yl]-[4-(dimethylamino)phenyl]methanone (PubChem CID 42953210) has the molecular formula C19H21ClN2O and a molecular weight of 328.84 g/mol. Its IUPAC name is [2-(4-chlorophenyl)pyrrolidin-1-yl]-[4-(dimethylamino)phenyl]methanone.
| Compound Name | [2-(4-chlorophenyl)pyrrolidin-1-yl]-[4-(dimethylamino)phenyl]methanone |
|---|---|
| PubChem CID | 42953210 |
| Molecular Formula | C19H21ClN2O |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [2-(4-chlorophenyl)pyrrolidin-1-yl]-[4-(dimethylamino)phenyl]methanone |
| SMILES | CN(C)c1ccc(C(=O)N2CCCC2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H21ClN2O/c1-21(2)17-11-7-15(8-12-17)19(23)22-13-3-4-18(22)14-5-9-16(20)10-6-14/h5-12,18H,3-4,13H2,1-2H3 |
| InChIKey | SKNOHLSJKZFDAZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |