C17H16N2O2S — CID 130430703
6-(methylsulfonylmethyl)-4-phenyl-1,3-dihydroisoindole-2-carbonitrile (PubChem CID 130430703) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 6-(methylsulfonylmethyl)-4-phenyl-1,3-dihydroisoindole-2-carbonitrile.
| Compound Name | 6-(methylsulfonylmethyl)-4-phenyl-1,3-dihydroisoindole-2-carbonitrile |
|---|---|
| PubChem CID | 130430703 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 6-(methylsulfonylmethyl)-4-phenyl-1,3-dihydroisoindole-2-carbonitrile |
| SMILES | CS(=O)(=O)Cc1cc2c(c(-c3ccccc3)c1)CN(C#N)C2 |
| InChI | InChI=1S/C17H16N2O2S/c1-22(20,21)11-13-7-15-9-19(12-18)10-17(15)16(8-13)14-5-3-2-4-6-14/h2-8H,9-11H2,1H3 |
| InChIKey | XJTVFXWZEYWUMM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|