C14H15N3 — CID 130432363
8-methyl-1,3,8-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11(16),14-pentaene (PubChem CID 130432363) has the molecular formula C14H15N3 and a molecular weight of 225.30 g/mol. Its IUPAC name is 8-methyl-1,3,8-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11(16),14-pentaene.
| Compound Name | 8-methyl-1,3,8-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11(16),14-pentaene |
|---|---|
| PubChem CID | 130432363 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 8-methyl-1,3,8-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11(16),14-pentaene |
| SMILES | CN1c2cccnc2N2C3=C(CCC=C3)CC12 |
| InChI | InChI=1S/C14H15N3/c1-16-12-7-4-8-15-14(12)17-11-6-3-2-5-10(11)9-13(16)17/h3-4,6-8,13H,2,5,9H2,1H3 |
| InChIKey | FXUVTSVAMDMDID-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |