C28H22FN3O2 — CID 130433690
2-[5-fluoro-2-methyl-3-[3-(1-quinolin-2-ylethenylamino)phenyl]indol-1-yl]acetic acid (PubChem CID 130433690) has the molecular formula C28H22FN3O2 and a molecular weight of 451.50 g/mol. Its IUPAC name is 2-[5-fluoro-2-methyl-3-[3-(1-quinolin-2-ylethenylamino)phenyl]indol-1-yl]acetic acid.
| Compound Name | 2-[5-fluoro-2-methyl-3-[3-(1-quinolin-2-ylethenylamino)phenyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 130433690 |
| Molecular Formula | C28H22FN3O2 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-[5-fluoro-2-methyl-3-[3-(1-quinolin-2-ylethenylamino)phenyl]indol-1-yl]acetic acid |
| SMILES | C=C(Nc1cccc(-c2c(C)n(CC(=O)O)c3ccc(F)cc23)c1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C28H22FN3O2/c1-17(24-12-10-19-6-3-4-9-25(19)31-24)30-22-8-5-7-20(14-22)28-18(2)32(16-27(33)34)26-13-11-21(29)15-23(26)28/h3-15,30H,1,16H2,2H3,(H,33,34) |
| InChIKey | LDHWAMCRKMOBMT-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |