C27H38N2O7 — CID 130433953
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1-[3-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]propanoyl]pyrrolidine-2-carboxylate (PubChem CID 130433953) has the molecular formula C27H38N2O7 and a molecular weight of 502.61 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1-[3-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1-[3-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 130433953 |
| Molecular Formula | C27H38N2O7 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1-[3-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]propanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC1(C)C2CCC1(C)C(OC(=O)C1CCCN1C(=O)CCNC(=O)C(O)Cc1ccc(O)c(O)c1)C2 |
| InChI | InChI=1S/C27H38N2O7/c1-26(2)17-8-10-27(26,3)22(15-17)36-25(35)18-5-4-12-29(18)23(33)9-11-28-24(34)21(32)14-16-6-7-19(30)20(31)13-16/h6-7,13,17-18,21-22,30-32H,4-5,8-12,14-15H2,1-3H3,(H,28,34) |
| InChIKey | NRLFCQKXWJCDFG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|