C32H44N2O7 — CID 130433976
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1-[2-cyclohexyl-2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]acetyl]-2,5-dihydropyrrole-2-carboxylate (PubChem CID 130433976) has the molecular formula C32H44N2O7 and a molecular weight of 568.71 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1-[2-cyclohexyl-2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]acetyl]-2,5-dihydropyrrole-2-carboxylate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1-[2-cyclohexyl-2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]acetyl]-2,5-dihydropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 130433976 |
| Molecular Formula | C32H44N2O7 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1-[2-cyclohexyl-2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]acetyl]-2,5-dihydropyrrole-2-carboxylate |
| SMILES | CC1(C)C2CCC1(C)C(OC(=O)C1C=CCN1C(=O)C(NC(=O)C(O)Cc1ccc(O)c(O)c1)C1CCCCC1)C2 |
| InChI | InChI=1S/C32H44N2O7/c1-31(2)21-13-14-32(31,3)26(18-21)41-30(40)22-10-7-15-34(22)29(39)27(20-8-5-4-6-9-20)33-28(38)25(37)17-19-11-12-23(35)24(36)16-19/h7,10-12,16,20-22,25-27,35-37H,4-6,8-9,13-15,17-18H2,1-3H3,(H,33,38) |
| InChIKey | FJRBHRXZWUDIMR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|