C29H44N2O7 — CID 130441192
[(3R)-3-ethyl-1,2,2-trimethylcyclopentyl] 1-[2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylate (PubChem CID 130441192) has the molecular formula C29H44N2O7 and a molecular weight of 532.68 g/mol. Its IUPAC name is [(3R)-3-ethyl-1,2,2-trimethylcyclopentyl] 1-[2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylate.
| Compound Name | [(3R)-3-ethyl-1,2,2-trimethylcyclopentyl] 1-[2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 130441192 |
| Molecular Formula | C29H44N2O7 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | [(3R)-3-ethyl-1,2,2-trimethylcyclopentyl] 1-[2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC[C@@H]1CCC(C)(OC(=O)C2CCCN2C(=O)C(NC(=O)C(O)Cc2ccc(O)c(O)c2)C(C)C)C1(C)C |
| InChI | InChI=1S/C29H44N2O7/c1-7-19-12-13-29(6,28(19,4)5)38-27(37)20-9-8-14-31(20)26(36)24(17(2)3)30-25(35)23(34)16-18-10-11-21(32)22(33)15-18/h10-11,15,17,19-20,23-24,32-34H,7-9,12-14,16H2,1-6H3,(H,30,35)/t19-,20?,23?,24?,29?/m1/s1 |
| InChIKey | RYDHUHHFSWLOQW-WOFNMFADSA-N |
| XLogP | 3.28 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|