C23H32FN3O6 — CID 130434029
3-(3,4-dihydroxyphenyl)-N-[1-[2-(3-fluoropiperidine-1-carbonyl)piperidin-1-yl]-1-oxopropan-2-yl]-2-hydroxypropanamide (PubChem CID 130434029) has the molecular formula C23H32FN3O6 and a molecular weight of 465.52 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-N-[1-[2-(3-fluoropiperidine-1-carbonyl)piperidin-1-yl]-1-oxopropan-2-yl]-2-hydroxypropanamide.
| Compound Name | 3-(3,4-dihydroxyphenyl)-N-[1-[2-(3-fluoropiperidine-1-carbonyl)piperidin-1-yl]-1-oxopropan-2-yl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 130434029 |
| Molecular Formula | C23H32FN3O6 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-N-[1-[2-(3-fluoropiperidine-1-carbonyl)piperidin-1-yl]-1-oxopropan-2-yl]-2-hydroxypropanamide |
| SMILES | CC(NC(=O)C(O)Cc1ccc(O)c(O)c1)C(=O)N1CCCCC1C(=O)N1CCCC(F)C1 |
| InChI | InChI=1S/C23H32FN3O6/c1-14(25-21(31)20(30)12-15-7-8-18(28)19(29)11-15)22(32)27-10-3-2-6-17(27)23(33)26-9-4-5-16(24)13-26/h7-8,11,14,16-17,20,28-30H,2-6,9-10,12-13H2,1H3,(H,25,31) |
| InChIKey | XUJKFQYPOCWBSO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|