C26H36FN3O6 — CID 130434036
3-(3,4-dihydroxyphenyl)-N-[1-[2-(3-fluoropiperidine-1-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]-2-hydroxypropanamide (PubChem CID 130434036) has the molecular formula C26H36FN3O6 and a molecular weight of 505.59 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-N-[1-[2-(3-fluoropiperidine-1-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]-2-hydroxypropanamide.
| Compound Name | 3-(3,4-dihydroxyphenyl)-N-[1-[2-(3-fluoropiperidine-1-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 130434036 |
| Molecular Formula | C26H36FN3O6 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-N-[1-[2-(3-fluoropiperidine-1-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]-2-hydroxypropanamide |
| SMILES | CC(NC(=O)C(O)Cc1ccc(O)c(O)c1)C(=O)N1C(C(=O)N2CCCC(F)C2)CC2CCCCC21 |
| InChI | InChI=1S/C26H36FN3O6/c1-15(28-24(34)23(33)12-16-8-9-21(31)22(32)11-16)25(35)30-19-7-3-2-5-17(19)13-20(30)26(36)29-10-4-6-18(27)14-29/h8-9,11,15,17-20,23,31-33H,2-7,10,12-14H2,1H3,(H,28,34) |
| InChIKey | DZEOQQNFDXBXMU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|