C22H30N2O6S2 — CID 130440925
S-cyclohexyl 3-[2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]propanoyl]-1,3-thiazolidine-4-carbothioate (PubChem CID 130440925) has the molecular formula C22H30N2O6S2 and a molecular weight of 482.62 g/mol. Its IUPAC name is S-cyclohexyl 3-[2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]propanoyl]-1,3-thiazolidine-4-carbothioate.
| Compound Name | S-cyclohexyl 3-[2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]propanoyl]-1,3-thiazolidine-4-carbothioate |
|---|---|
| PubChem CID | 130440925 |
| Molecular Formula | C22H30N2O6S2 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | S-cyclohexyl 3-[2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]propanoyl]-1,3-thiazolidine-4-carbothioate |
| SMILES | CC(NC(=O)C(O)Cc1ccc(O)c(O)c1)C(=O)N1CSCC1C(=O)SC1CCCCC1 |
| InChI | InChI=1S/C22H30N2O6S2/c1-13(23-20(28)19(27)10-14-7-8-17(25)18(26)9-14)21(29)24-12-31-11-16(24)22(30)32-15-5-3-2-4-6-15/h7-9,13,15-16,19,25-27H,2-6,10-12H2,1H3,(H,23,28) |
| InChIKey | ADGGXDCHFVEHFK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|