C23H31NO6S — CID 169430768
S-cyclohexyl 1-[6-(3,4-dihydroxyphenyl)-5-hydroxy-2-methyl-4-oxohexanoyl]azetidine-2-carbothioate (PubChem CID 169430768) has the molecular formula C23H31NO6S and a molecular weight of 449.57 g/mol. Its IUPAC name is S-cyclohexyl 1-[6-(3,4-dihydroxyphenyl)-5-hydroxy-2-methyl-4-oxohexanoyl]azetidine-2-carbothioate.
| Compound Name | S-cyclohexyl 1-[6-(3,4-dihydroxyphenyl)-5-hydroxy-2-methyl-4-oxohexanoyl]azetidine-2-carbothioate |
|---|---|
| PubChem CID | 169430768 |
| Molecular Formula | C23H31NO6S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | S-cyclohexyl 1-[6-(3,4-dihydroxyphenyl)-5-hydroxy-2-methyl-4-oxohexanoyl]azetidine-2-carbothioate |
| SMILES | CC(CC(=O)C(O)Cc1ccc(O)c(O)c1)C(=O)N1CCC1C(=O)SC1CCCCC1 |
| InChI | InChI=1S/C23H31NO6S/c1-14(11-19(26)21(28)13-15-7-8-18(25)20(27)12-15)22(29)24-10-9-17(24)23(30)31-16-5-3-2-4-6-16/h7-8,12,14,16-17,21,25,27-28H,2-6,9-11,13H2,1H3 |
| InChIKey | VVSTVWAGSHNEOU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|