C17H22N2O6 — CID 131968744
3-(3,4-dihydroxyphenyl)-N-[1-(2-formylazetidin-1-yl)-1-oxopropan-2-yl]-2-hydroxy-N-methylpropanamide (PubChem CID 131968744) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-N-[1-(2-formylazetidin-1-yl)-1-oxopropan-2-yl]-2-hydroxy-N-methylpropanamide.
| Compound Name | 3-(3,4-dihydroxyphenyl)-N-[1-(2-formylazetidin-1-yl)-1-oxopropan-2-yl]-2-hydroxy-N-methylpropanamide |
|---|---|
| PubChem CID | 131968744 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-N-[1-(2-formylazetidin-1-yl)-1-oxopropan-2-yl]-2-hydroxy-N-methylpropanamide |
| SMILES | CC(C(=O)N1CCC1C=O)N(C)C(=O)C(O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H22N2O6/c1-10(16(24)19-6-5-12(19)9-20)18(2)17(25)15(23)8-11-3-4-13(21)14(22)7-11/h3-4,7,9-10,12,15,21-23H,5-6,8H2,1-2H3 |
| InChIKey | IKDHVLNZDNRCDY-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|