C23H32N2O6S — CID 130441049
S-cyclohexyl 1-[2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]propanoyl]pyrrolidine-2-carbothioate (PubChem CID 130441049) has the molecular formula C23H32N2O6S and a molecular weight of 464.58 g/mol. Its IUPAC name is S-cyclohexyl 1-[2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]propanoyl]pyrrolidine-2-carbothioate.
| Compound Name | S-cyclohexyl 1-[2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]propanoyl]pyrrolidine-2-carbothioate |
|---|---|
| PubChem CID | 130441049 |
| Molecular Formula | C23H32N2O6S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | S-cyclohexyl 1-[2-[[3-(3,4-dihydroxyphenyl)-2-hydroxypropanoyl]amino]propanoyl]pyrrolidine-2-carbothioate |
| SMILES | CC(NC(=O)C(O)Cc1ccc(O)c(O)c1)C(=O)N1CCCC1C(=O)SC1CCCCC1 |
| InChI | InChI=1S/C23H32N2O6S/c1-14(24-21(29)20(28)13-15-9-10-18(26)19(27)12-15)22(30)25-11-5-8-17(25)23(31)32-16-6-3-2-4-7-16/h9-10,12,14,16-17,20,26-28H,2-8,11,13H2,1H3,(H,24,29) |
| InChIKey | HAYNMTOSSDPGQZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|