C25H38N2O5 — CID 130440927
(3-ethyl-1,2,2-trimethylcyclopentyl) 1-[2-[(3,4-dihydroxyphenyl)methylamino]propanoyl]pyrrolidine-2-carboxylate (PubChem CID 130440927) has the molecular formula C25H38N2O5 and a molecular weight of 446.59 g/mol. Its IUPAC name is (3-ethyl-1,2,2-trimethylcyclopentyl) 1-[2-[(3,4-dihydroxyphenyl)methylamino]propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | (3-ethyl-1,2,2-trimethylcyclopentyl) 1-[2-[(3,4-dihydroxyphenyl)methylamino]propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 130440927 |
| Molecular Formula | C25H38N2O5 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | (3-ethyl-1,2,2-trimethylcyclopentyl) 1-[2-[(3,4-dihydroxyphenyl)methylamino]propanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCC1CCC(C)(OC(=O)C2CCCN2C(=O)C(C)NCc2ccc(O)c(O)c2)C1(C)C |
| InChI | InChI=1S/C25H38N2O5/c1-6-18-11-12-25(5,24(18,3)4)32-23(31)19-8-7-13-27(19)22(30)16(2)26-15-17-9-10-20(28)21(29)14-17/h9-10,14,16,18-19,26,28-29H,6-8,11-13,15H2,1-5H3 |
| InChIKey | HBTUCEFNJMMVIF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|