C26H36N2O7 — CID 130441190
2-(5,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl)ethyl 1-[(2S)-2-[(3,4,5-trihydroxybenzoyl)amino]propanoyl]pyrrolidine-2-carboxylate (PubChem CID 130441190) has the molecular formula C26H36N2O7 and a molecular weight of 488.58 g/mol. Its IUPAC name is 2-(5,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl)ethyl 1-[(2S)-2-[(3,4,5-trihydroxybenzoyl)amino]propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | 2-(5,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl)ethyl 1-[(2S)-2-[(3,4,5-trihydroxybenzoyl)amino]propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 130441190 |
| Molecular Formula | C26H36N2O7 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 2-(5,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl)ethyl 1-[(2S)-2-[(3,4,5-trihydroxybenzoyl)amino]propanoyl]pyrrolidine-2-carboxylate |
| SMILES | C[C@H](NC(=O)c1cc(O)c(O)c(O)c1)C(=O)N1CCCC1C(=O)OCCC1CCC2(C)C1C2(C)C |
| InChI | InChI=1S/C26H36N2O7/c1-14(27-22(32)16-12-18(29)20(31)19(30)13-16)23(33)28-10-5-6-17(28)24(34)35-11-8-15-7-9-26(4)21(15)25(26,2)3/h12-15,17,21,29-31H,5-11H2,1-4H3,(H,27,32)/t14-,15?,17?,21?,26?/m0/s1 |
| InChIKey | GYVDKMOLCZLAOX-UKBONHFBSA-N |
| XLogP | 2.92 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|