C28H37NO6 — CID 147241789
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (2S)-1-[(E,2R)-6-(3,4-dihydroxyphenyl)-2-methyl-4-oxohex-5-enoyl]pyrrolidine-2-carboxylate (PubChem CID 147241789) has the molecular formula C28H37NO6 and a molecular weight of 483.61 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (2S)-1-[(E,2R)-6-(3,4-dihydroxyphenyl)-2-methyl-4-oxohex-5-enoyl]pyrrolidine-2-carboxylate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (2S)-1-[(E,2R)-6-(3,4-dihydroxyphenyl)-2-methyl-4-oxohex-5-enoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 147241789 |
| Molecular Formula | C28H37NO6 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (2S)-1-[(E,2R)-6-(3,4-dihydroxyphenyl)-2-methyl-4-oxohex-5-enoyl]pyrrolidine-2-carboxylate |
| SMILES | C[C@H](CC(=O)/C=C/c1ccc(O)c(O)c1)C(=O)N1CCC[C@H]1C(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C28H37NO6/c1-17(14-20(30)9-7-18-8-10-22(31)23(32)15-18)25(33)29-13-5-6-21(29)26(34)35-24-16-19-11-12-28(24,4)27(19,2)3/h7-10,15,17,19,21,24,31-32H,5-6,11-14,16H2,1-4H3/b9-7+/t17-,19?,21+,24?,28?/m1/s1 |
| InChIKey | CKXMDOYWGGRLKZ-XHOGHPLFSA-N |
| XLogP | 4.46 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|