C22H28O3 — CID 139802018
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (E)-3-(5-ethenyl-2-hydroxyphenyl)-2-methylprop-2-enoate (PubChem CID 139802018) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (E)-3-(5-ethenyl-2-hydroxyphenyl)-2-methylprop-2-enoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (E)-3-(5-ethenyl-2-hydroxyphenyl)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139802018 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (E)-3-(5-ethenyl-2-hydroxyphenyl)-2-methylprop-2-enoate |
| SMILES | C=Cc1ccc(O)c(/C=C(\C)C(=O)OC2CC3CCC2(C)C3(C)C)c1 |
| InChI | InChI=1S/C22H28O3/c1-6-15-7-8-18(23)16(12-15)11-14(2)20(24)25-19-13-17-9-10-22(19,5)21(17,3)4/h6-8,11-12,17,19,23H,1,9-10,13H2,2-5H3/b14-11+ |
| InChIKey | WVQVDBSHGWIWNW-SDNWHVSQSA-N |
| XLogP | 5.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|