C8H15F2N — CID 130434383
4-ethyl-2,5-difluoro-1-methylpiperidine (PubChem CID 130434383) has the molecular formula C8H15F2N and a molecular weight of 163.21 g/mol. Its IUPAC name is 4-ethyl-2,5-difluoro-1-methylpiperidine.
| Compound Name | 4-ethyl-2,5-difluoro-1-methylpiperidine |
|---|---|
| PubChem CID | 130434383 |
| Molecular Formula | C8H15F2N |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | 4-ethyl-2,5-difluoro-1-methylpiperidine |
| SMILES | CCC1CC(F)N(C)CC1F |
| InChI | InChI=1S/C8H15F2N/c1-3-6-4-8(10)11(2)5-7(6)9/h6-8H,3-5H2,1-2H3 |
| InChIKey | DCJQFXWTQACSCQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|