C19H21N3O3 — CID 130435930
(E)-3-anilino-2-[(5,6-dimethoxy-2-propan-2-yl-3-pyridinyl)oxy]prop-2-enenitrile (PubChem CID 130435930) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is (E)-3-anilino-2-[(5,6-dimethoxy-2-propan-2-yl-3-pyridinyl)oxy]prop-2-enenitrile.
| Compound Name | (E)-3-anilino-2-[(5,6-dimethoxy-2-propan-2-yl-3-pyridinyl)oxy]prop-2-enenitrile |
|---|---|
| PubChem CID | 130435930 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (E)-3-anilino-2-[(5,6-dimethoxy-2-propan-2-yl-3-pyridinyl)oxy]prop-2-enenitrile |
| SMILES | COc1cc(O/C(C#N)=C/Nc2ccccc2)c(C(C)C)nc1OC |
| InChI | InChI=1S/C19H21N3O3/c1-13(2)18-16(10-17(23-3)19(22-18)24-4)25-15(11-20)12-21-14-8-6-5-7-9-14/h5-10,12-13,21H,1-4H3/b15-12+ |
| InChIKey | QVXDODXQWGGKFZ-NTCAYCPXSA-N |
| XLogP | 4.08 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|