C22H21N3O2 — CID 70418543
3-anilino-2-[(3,5-dimethoxy-4-pyrrol-1-ylphenyl)methyl]prop-2-enenitrile (PubChem CID 70418543) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-anilino-2-[(3,5-dimethoxy-4-pyrrol-1-ylphenyl)methyl]prop-2-enenitrile.
| Compound Name | 3-anilino-2-[(3,5-dimethoxy-4-pyrrol-1-ylphenyl)methyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 70418543 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 3-anilino-2-[(3,5-dimethoxy-4-pyrrol-1-ylphenyl)methyl]prop-2-enenitrile |
| SMILES | COc1cc(CC(C#N)=CNc2ccccc2)cc(OC)c1-n1cccc1 |
| InChI | InChI=1S/C22H21N3O2/c1-26-20-13-17(14-21(27-2)22(20)25-10-6-7-11-25)12-18(15-23)16-24-19-8-4-3-5-9-19/h3-11,13-14,16,24H,12H2,1-2H3 |
| InChIKey | CTKKPTRKUCMUMS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|