C13H14FNO3 — CID 70617725
2-[(4-fluoro-3,5-dimethoxyphenyl)methyl]-3-methoxyprop-2-enenitrile (PubChem CID 70617725) has the molecular formula C13H14FNO3 and a molecular weight of 251.26 g/mol. Its IUPAC name is 2-[(4-fluoro-3,5-dimethoxyphenyl)methyl]-3-methoxyprop-2-enenitrile.
| Compound Name | 2-[(4-fluoro-3,5-dimethoxyphenyl)methyl]-3-methoxyprop-2-enenitrile |
|---|---|
| PubChem CID | 70617725 |
| Molecular Formula | C13H14FNO3 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 2-[(4-fluoro-3,5-dimethoxyphenyl)methyl]-3-methoxyprop-2-enenitrile |
| SMILES | COC=C(C#N)Cc1cc(OC)c(F)c(OC)c1 |
| InChI | InChI=1S/C13H14FNO3/c1-16-8-10(7-15)4-9-5-11(17-2)13(14)12(6-9)18-3/h5-6,8H,4H2,1-3H3 |
| InChIKey | HLGXSFJJNCBRED-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|