C21H35N3O4 — CID 130437313
1-(4-tert-butylphenyl)-3-[3-[1-(4-hydroxyoxolan-3-yl)oxyethyl-methylamino]propyl]urea (PubChem CID 130437313) has the molecular formula C21H35N3O4 and a molecular weight of 393.53 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[3-[1-(4-hydroxyoxolan-3-yl)oxyethyl-methylamino]propyl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[3-[1-(4-hydroxyoxolan-3-yl)oxyethyl-methylamino]propyl]urea |
|---|---|
| PubChem CID | 130437313 |
| Molecular Formula | C21H35N3O4 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[3-[1-(4-hydroxyoxolan-3-yl)oxyethyl-methylamino]propyl]urea |
| SMILES | CC(OC1COCC1O)N(C)CCCNC(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H35N3O4/c1-15(28-19-14-27-13-18(19)25)24(5)12-6-11-22-20(26)23-17-9-7-16(8-10-17)21(2,3)4/h7-10,15,18-19,25H,6,11-14H2,1-5H3,(H2,22,23,26) |
| InChIKey | OMFYVNQKVBASMM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|