C23H38N4O4 — CID 130228103
1-[3-[[(2R,3S,4R,5R)-5-amino-3,4-dihydroxyoxolan-2-yl]methyl-cyclobutylamino]propyl]-3-(4-tert-butylphenyl)urea (PubChem CID 130228103) has the molecular formula C23H38N4O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is 1-[3-[[(2R,3S,4R,5R)-5-amino-3,4-dihydroxyoxolan-2-yl]methyl-cyclobutylamino]propyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[3-[[(2R,3S,4R,5R)-5-amino-3,4-dihydroxyoxolan-2-yl]methyl-cyclobutylamino]propyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 130228103 |
| Molecular Formula | C23H38N4O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 1-[3-[[(2R,3S,4R,5R)-5-amino-3,4-dihydroxyoxolan-2-yl]methyl-cyclobutylamino]propyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)NCCCN(C[C@H]2O[C@@H](N)[C@H](O)[C@@H]2O)C2CCC2)cc1 |
| InChI | InChI=1S/C23H38N4O4/c1-23(2,3)15-8-10-16(11-9-15)26-22(30)25-12-5-13-27(17-6-4-7-17)14-18-19(28)20(29)21(24)31-18/h8-11,17-21,28-29H,4-7,12-14,24H2,1-3H3,(H2,25,26,30)/t18-,19-,20-,21-/m1/s1 |
| InChIKey | QJDYZHDYZDOGRN-XRXFAXGQSA-N |
| XLogP | 1.76 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|