C27H48N8O4 — CID 67989163
1-(4-tert-butylphenyl)-3-[3-[cyclobutyl-[[(2R,3S,4R,5R)-5-[(5,6-diamino-1,3-diazinan-4-yl)amino]-3,4-dihydroxyoxolan-2-yl]methyl]amino]propyl]urea (PubChem CID 67989163) has the molecular formula C27H48N8O4 and a molecular weight of 548.73 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[3-[cyclobutyl-[[(2R,3S,4R,5R)-5-[(5,6-diamino-1,3-diazinan-4-yl)amino]-3,4-dihydroxyoxolan-2-yl]methyl]amino]propyl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[3-[cyclobutyl-[[(2R,3S,4R,5R)-5-[(5,6-diamino-1,3-diazinan-4-yl)amino]-3,4-dihydroxyoxolan-2-yl]methyl]amino]propyl]urea |
|---|---|
| PubChem CID | 67989163 |
| Molecular Formula | C27H48N8O4 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.38 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[3-[cyclobutyl-[[(2R,3S,4R,5R)-5-[(5,6-diamino-1,3-diazinan-4-yl)amino]-3,4-dihydroxyoxolan-2-yl]methyl]amino]propyl]urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)NCCCN(C[C@H]2O[C@@H](NC3NCNC(N)C3N)[C@H](O)[C@@H]2O)C2CCC2)cc1 |
| InChI | InChI=1S/C27H48N8O4/c1-27(2,3)16-8-10-17(11-9-16)33-26(38)30-12-5-13-35(18-6-4-7-18)14-19-21(36)22(37)25(39-19)34-24-20(28)23(29)31-15-32-24/h8-11,18-25,31-32,34,36-37H,4-7,12-15,28-29H2,1-3H3,(H2,30,33,38)/t19-,20?,21-,22-,23?,24?,25-/m1/s1 |
| InChIKey | VKCLRDQZARFTFZ-DHDMQHMTSA-N |
| XLogP | -0.52 |
| TPSA | 182.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|