C27H40N8O5 — CID 90369973
1-[3-[[(2R,3S,4R,5R)-5-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(4-phenoxyphenyl)urea (PubChem CID 90369973) has the molecular formula C27H40N8O5 and a molecular weight of 556.67 g/mol. Its IUPAC name is 1-[3-[[(2R,3S,4R,5R)-5-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[3-[[(2R,3S,4R,5R)-5-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 90369973 |
| Molecular Formula | C27H40N8O5 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | 1-[3-[[(2R,3S,4R,5R)-5-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(4-phenoxyphenyl)urea |
| SMILES | CN(CCCNC(=O)Nc1ccc(Oc2ccccc2)cc1)C[C@H]1O[C@@H](N2CNC3C(N)NCNC32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H40N8O5/c1-34(14-20-22(36)23(37)26(40-20)35-16-32-21-24(28)30-15-31-25(21)35)13-5-12-29-27(38)33-17-8-10-19(11-9-17)39-18-6-3-2-4-7-18/h2-4,6-11,20-26,30-32,36-37H,5,12-16,28H2,1H3,(H2,29,33,38)/t20-,21?,22-,23-,24?,25?,26-/m1/s1 |
| InChIKey | FUEBHWIKPUBALA-MKAFPEBVSA-N |
| XLogP | -0.64 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|