About 3-bromo-1-[(4-ethoxy-2,6-difluorophenyl)methyl]pyrazolo[5,4-c]pyridine
3-bromo-1-[(4-ethoxy-2,6-difluorophenyl)methyl]pyrazolo[5,4-c]pyridine (PubChem CID 130437935) has the molecular formula C15H12BrF2N3O
and a molecular weight of 368.18 g/mol. Its IUPAC name is 3-bromo-1-[(4-ethoxy-2,6-difluorophenyl)methyl]pyrazolo[5,4-c]pyridine.
Molecular Properties
| Compound Name | 3-bromo-1-[(4-ethoxy-2,6-difluorophenyl)methyl]pyrazolo[5,4-c]pyridine |
| PubChem CID | 130437935 |
| Molecular Formula | C15H12BrF2N3O |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 3-bromo-1-[(4-ethoxy-2,6-difluorophenyl)methyl]pyrazolo[5,4-c]pyridine |
| SMILES | CCOc1cc(F)c(Cn2nc(Br)c3ccncc32)c(F)c1 |
| InChI | InChI=1S/C15H12BrF2N3O/c1-2-22-9-5-12(17)11(13(18)6-9)8-21-14-7-19-4-3-10(14)15(16)20-21/h3-7H,2,8H2,1H3 |
| InChIKey | CUGXWNAZAGGQSK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-1-[(4-ethoxy-2,6-difluorophenyl)methyl]pyrazolo[5,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-[(4-ethoxy-2,6-difluorophenyl)methyl]pyrazolo[5,4-c]pyridine?
The IUPAC name of 3-bromo-1-[(4-ethoxy-2,6-difluorophenyl)methyl]pyrazolo[5,4-c]pyridine (CID 130437935) is 3-bromo-1-[(4-ethoxy-2,6-difluorophenyl)methyl]pyrazolo[5,4-c]pyridine.
What is the SMILES notation for 3-bromo-1-[(4-ethoxy-2,6-difluorophenyl)methyl]pyrazolo[5,4-c]pyridine?
The canonical SMILES for 3-bromo-1-[(4-ethoxy-2,6-difluorophenyl)methyl]pyrazolo[5,4-c]pyridine is CCOc1cc(F)c(Cn2nc(Br)c3ccncc32)c(F)c1.
What is the InChIKey of 3-bromo-1-[(4-ethoxy-2,6-difluorophenyl)methyl]pyrazolo[5,4-c]pyridine?
The InChIKey is CUGXWNAZAGGQSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrF2N3O/c1-2-22-9-5-12(17)11(13(18)6-9)8-21-14-7-19-4-3-10(14)15(16)20-21/h3-7H,2,8H2,1H3.
What are the key properties of 3-bromo-1-[(4-ethoxy-2,6-difluorophenyl)methyl]pyrazolo[5,4-c]pyridine?
3-bromo-1-[(4-ethoxy-2,6-difluorophenyl)methyl]pyrazolo[5,4-c]pyridine has a molecular weight of 368.18 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-[(4-ethoxy-2,6-difluorophenyl)methyl]pyrazolo[5,4-c]pyridine is sourced from PubChem (CID 130437935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).