C30H42BrF3O9 — CID 130438628
[2-(3-acetyloxypropoxycarbonyloxymethyl)-2-methyl-3-oxo-3-(7,7,7-trifluoroheptoxy)propyl] 4-bromo-2,2-dimethyl-4-phenylbutanoate (PubChem CID 130438628) has the molecular formula C30H42BrF3O9 and a molecular weight of 683.56 g/mol. Its IUPAC name is [2-(3-acetyloxypropoxycarbonyloxymethyl)-2-methyl-3-oxo-3-(7,7,7-trifluoroheptoxy)propyl] 4-bromo-2,2-dimethyl-4-phenylbutanoate.
| Compound Name | [2-(3-acetyloxypropoxycarbonyloxymethyl)-2-methyl-3-oxo-3-(7,7,7-trifluoroheptoxy)propyl] 4-bromo-2,2-dimethyl-4-phenylbutanoate |
|---|---|
| PubChem CID | 130438628 |
| Molecular Formula | C30H42BrF3O9 |
| Molecular Weight | 683.56 g/mol |
| Exact Mass | 682.20 |
| IUPAC Name | [2-(3-acetyloxypropoxycarbonyloxymethyl)-2-methyl-3-oxo-3-(7,7,7-trifluoroheptoxy)propyl] 4-bromo-2,2-dimethyl-4-phenylbutanoate |
| SMILES | CC(=O)OCCCOC(=O)OCC(C)(COC(=O)C(C)(C)CC(Br)c1ccccc1)C(=O)OCCCCCCC(F)(F)F |
| InChI | InChI=1S/C30H42BrF3O9/c1-22(35)39-17-12-18-41-27(38)43-21-29(4,26(37)40-16-11-6-5-10-15-30(32,33)34)20-42-25(36)28(2,3)19-24(31)23-13-8-7-9-14-23/h7-9,13-14,24H,5-6,10-12,15-21H2,1-4H3 |
| InChIKey | DKEVNTOLENRNMF-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.56 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|