C32H46BrF3O9 — CID 130438630
[2-(3-acetyloxypropoxycarbonyloxymethyl)-2-methyl-3-oxo-3-(9,9,9-trifluorononoxy)propyl] 4-bromo-2,2-dimethyl-4-phenylbutanoate (PubChem CID 130438630) has the molecular formula C32H46BrF3O9 and a molecular weight of 711.61 g/mol. Its IUPAC name is [2-(3-acetyloxypropoxycarbonyloxymethyl)-2-methyl-3-oxo-3-(9,9,9-trifluorononoxy)propyl] 4-bromo-2,2-dimethyl-4-phenylbutanoate.
| Compound Name | [2-(3-acetyloxypropoxycarbonyloxymethyl)-2-methyl-3-oxo-3-(9,9,9-trifluorononoxy)propyl] 4-bromo-2,2-dimethyl-4-phenylbutanoate |
|---|---|
| PubChem CID | 130438630 |
| Molecular Formula | C32H46BrF3O9 |
| Molecular Weight | 711.61 g/mol |
| Exact Mass | 710.23 |
| IUPAC Name | [2-(3-acetyloxypropoxycarbonyloxymethyl)-2-methyl-3-oxo-3-(9,9,9-trifluorononoxy)propyl] 4-bromo-2,2-dimethyl-4-phenylbutanoate |
| SMILES | CC(=O)OCCCOC(=O)OCC(C)(COC(=O)C(C)(C)CC(Br)c1ccccc1)C(=O)OCCCCCCCCC(F)(F)F |
| InChI | InChI=1S/C32H46BrF3O9/c1-24(37)41-19-14-20-43-29(40)45-23-31(4,28(39)42-18-13-8-6-5-7-12-17-32(34,35)36)22-44-27(38)30(2,3)21-26(33)25-15-10-9-11-16-25/h9-11,15-16,26H,5-8,12-14,17-23H2,1-4H3 |
| InChIKey | IAIQJKDQEAOIFC-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.61 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|