C24H25NO4 — CID 130439274
[(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 4-methylbenzoate (PubChem CID 130439274) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is [(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 4-methylbenzoate.
| Compound Name | [(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 130439274 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | [(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 4-methylbenzoate |
| SMILES | COc1ccc2c3c1OC1C[C@@H](OC(=O)c4ccc(C)cc4)C=C[C@@]31CCN2C |
| InChI | InChI=1S/C24H25NO4/c1-15-4-6-16(7-5-15)23(26)28-17-10-11-24-12-13-25(2)18-8-9-19(27-3)22(21(18)24)29-20(24)14-17/h4-11,17,20H,12-14H2,1-3H3/t17-,20?,24-/m0/s1 |
| InChIKey | LDLAYSSURYPSTA-UUOWWMLSSA-N |
| XLogP | 4.03 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|