C24H21ClF3NO4 — CID 166802736
[(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 4-chloro-3-(trifluoromethyl)benzoate (PubChem CID 166802736) has the molecular formula C24H21ClF3NO4 and a molecular weight of 479.88 g/mol. Its IUPAC name is [(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 4-chloro-3-(trifluoromethyl)benzoate.
| Compound Name | [(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 4-chloro-3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 166802736 |
| Molecular Formula | C24H21ClF3NO4 |
| Molecular Weight | 479.88 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | [(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 4-chloro-3-(trifluoromethyl)benzoate |
| SMILES | COc1ccc2c3c1OC1C[C@@H](OC(=O)c4ccc(Cl)c(C(F)(F)F)c4)C=C[C@@]31CCN2C |
| InChI | InChI=1S/C24H21ClF3NO4/c1-29-10-9-23-8-7-14(12-19(23)33-21-18(31-2)6-5-17(29)20(21)23)32-22(30)13-3-4-16(25)15(11-13)24(26,27)28/h3-8,11,14,19H,9-10,12H2,1-2H3/t14-,19?,23-/m0/s1 |
| InChIKey | NAHBFZNXOOLZLW-BIZKTGEDSA-N |
| XLogP | 5.39 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.88 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|